C14H12ClFN2O2 — CID 142651458
5-fluoro-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one;hydrochloride (PubChem CID 142651458) has the molecular formula C14H12ClFN2O2 and a molecular weight of 294.71 g/mol. Its IUPAC name is 5-fluoro-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one;hydrochloride.
| Compound Name | 5-fluoro-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one;hydrochloride |
|---|---|
| PubChem CID | 142651458 |
| Molecular Formula | C14H12ClFN2O2 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-fluoro-3-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one;hydrochloride |
| SMILES | COc1cc[nH]c1C=C1C(=O)Nc2ccc(F)cc21.Cl |
| InChI | InChI=1S/C14H11FN2O2.ClH/c1-19-13-4-5-16-12(13)7-10-9-6-8(15)2-3-11(9)17-14(10)18;/h2-7,16H,1H3,(H,17,18);1H |
| InChIKey | KZVCJHPNQRPBGH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|