C22H24FNO2 — CID 54391150
5-fluoro-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one (PubChem CID 54391150) has the molecular formula C22H24FNO2 and a molecular weight of 353.44 g/mol. Its IUPAC name is 5-fluoro-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one.
| Compound Name | 5-fluoro-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 54391150 |
| Molecular Formula | C22H24FNO2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 5-fluoro-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one |
| SMILES | COc1c(C(C)C)cc(C=C2C(=O)Nc3ccc(F)cc32)cc1C(C)C |
| InChI | InChI=1S/C22H24FNO2/c1-12(2)16-8-14(9-17(13(3)4)21(16)26-5)10-19-18-11-15(23)6-7-20(18)24-22(19)25/h6-13H,1-5H3,(H,24,25) |
| InChIKey | VGSKQDFVALTLRO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|