C23H27NO2 — CID 22500209
(3E)-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-5-methyl-1H-indol-2-one (PubChem CID 22500209) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is (3E)-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-5-methyl-1H-indol-2-one.
| Compound Name | (3E)-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-5-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 22500209 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (3E)-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-5-methyl-1H-indol-2-one |
| SMILES | COc1c(C(C)C)cc(/C=C2/C(=O)Nc3ccc(C)cc32)cc1C(C)C |
| InChI | InChI=1S/C23H27NO2/c1-13(2)17-10-16(11-18(14(3)4)22(17)26-6)12-20-19-9-15(5)7-8-21(19)24-23(20)25/h7-14H,1-6H3,(H,24,25)/b20-12+ |
| InChIKey | DUIPRNYYGNYVGP-UDWIEESQSA-N |
| XLogP | 5.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|