C23H27NO3 — CID 22500303
(3E)-5-methoxy-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one (PubChem CID 22500303) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is (3E)-5-methoxy-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-5-methoxy-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 22500303 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (3E)-5-methoxy-3-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methylidene]-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)/C(=C\c1cc(C(C)C)c(OC)c(C(C)C)c1)C(=O)N2 |
| InChI | InChI=1S/C23H27NO3/c1-13(2)17-9-15(10-18(14(3)4)22(17)27-6)11-20-19-12-16(26-5)7-8-21(19)24-23(20)25/h7-14H,1-6H3,(H,24,25)/b20-11+ |
| InChIKey | ZUSFTVLLEUKZJH-RGVLZGJSSA-N |
| XLogP | 5.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|