C15H10FNO2 — CID 171130402
5-fluoro-3-[(3-hydroxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 171130402) has the molecular formula C15H10FNO2 and a molecular weight of 255.25 g/mol. Its IUPAC name is 5-fluoro-3-[(3-hydroxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5-fluoro-3-[(3-hydroxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 171130402 |
| Molecular Formula | C15H10FNO2 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 5-fluoro-3-[(3-hydroxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1=Cc1cccc(O)c1 |
| InChI | InChI=1S/C15H10FNO2/c16-10-4-5-14-12(8-10)13(15(19)17-14)7-9-2-1-3-11(18)6-9/h1-8,18H,(H,17,19) |
| InChIKey | VDKXSTXYWXQWKZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|