C12H10N2O2S — CID 18626975
(4E)-4-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-6H-thieno[2,3-b]pyrrol-5-one (PubChem CID 18626975) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is (4E)-4-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-6H-thieno[2,3-b]pyrrol-5-one.
| Compound Name | (4E)-4-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-6H-thieno[2,3-b]pyrrol-5-one |
|---|---|
| PubChem CID | 18626975 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (4E)-4-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-6H-thieno[2,3-b]pyrrol-5-one |
| SMILES | COc1cc[nH]c1/C=C1/C(=O)Nc2sccc21 |
| InChI | InChI=1S/C12H10N2O2S/c1-16-10-2-4-13-9(10)6-8-7-3-5-17-12(7)14-11(8)15/h2-6,13H,1H3,(H,14,15)/b8-6+ |
| InChIKey | YMOYTSSMKXZCFR-SOFGYWHQSA-N |
| XLogP | 2.58 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|