C14H14N2OS — CID 59043151
(4Z)-4-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-6H-thieno[2,3-b]pyrrol-5-one (PubChem CID 59043151) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is (4Z)-4-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-6H-thieno[2,3-b]pyrrol-5-one.
| Compound Name | (4Z)-4-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-6H-thieno[2,3-b]pyrrol-5-one |
|---|---|
| PubChem CID | 59043151 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (4Z)-4-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-6H-thieno[2,3-b]pyrrol-5-one |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3sccc32)c(C)c1C |
| InChI | InChI=1S/C14H14N2OS/c1-7-8(2)12(15-9(7)3)6-11-10-4-5-18-14(10)16-13(11)17/h4-6,15H,1-3H3,(H,16,17)/b11-6- |
| InChIKey | HBWFULRBQYKSOS-WDZFZDKYSA-N |
| XLogP | 3.49 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|