C23H21FN2OS — CID 142189816
(3Z)-5-[(2-fluorophenyl)methylsulfanyl]-3-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one (PubChem CID 142189816) has the molecular formula C23H21FN2OS and a molecular weight of 392.50 g/mol. Its IUPAC name is (3Z)-5-[(2-fluorophenyl)methylsulfanyl]-3-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-[(2-fluorophenyl)methylsulfanyl]-3-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 142189816 |
| Molecular Formula | C23H21FN2OS |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (3Z)-5-[(2-fluorophenyl)methylsulfanyl]-3-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(SCc4ccccc4F)cc32)c(C)c1C |
| InChI | InChI=1S/C23H21FN2OS/c1-13-14(2)22(25-15(13)3)11-19-18-10-17(8-9-21(18)26-23(19)27)28-12-16-6-4-5-7-20(16)24/h4-11,25H,12H2,1-3H3,(H,26,27)/b19-11- |
| InChIKey | OFCROELQKJUGCB-ODLFYWEKSA-N |
| XLogP | 5.86 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|