C23H30FN5O3 — CID 142214958
N,N-bis[2-(methylamino)ethyl]formamide;5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde (PubChem CID 142214958) has the molecular formula C23H30FN5O3 and a molecular weight of 443.52 g/mol. Its IUPAC name is N,N-bis[2-(methylamino)ethyl]formamide;5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde.
| Compound Name | N,N-bis[2-(methylamino)ethyl]formamide;5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 142214958 |
| Molecular Formula | C23H30FN5O3 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | N,N-bis[2-(methylamino)ethyl]formamide;5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde |
| SMILES | CNCCN(C=O)CCNC.Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1C=O |
| InChI | InChI=1S/C16H13FN2O2.C7H17N3O/c1-8-13(7-20)9(2)18-15(8)6-12-11-5-10(17)3-4-14(11)19-16(12)21;1-8-3-5-10(7-11)6-4-9-2/h3-7,18H,1-2H3,(H,19,21);7-9H,3-6H2,1-2H3/b12-6-; |
| InChIKey | UZRFWLVVGNNYCA-DAMYXMBDSA-N |
| XLogP | 1.96 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|