C30H38FN5O6 — CID 161332695
N',N'-diethylethane-1,2-diamine;5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid;5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid (PubChem CID 161332695) has the molecular formula C30H38FN5O6 and a molecular weight of 583.66 g/mol. Its IUPAC name is N',N'-diethylethane-1,2-diamine;5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid;5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | N',N'-diethylethane-1,2-diamine;5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid;5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 161332695 |
| Molecular Formula | C30H38FN5O6 |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | N',N'-diethylethane-1,2-diamine;5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid;5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
| SMILES | CCN(CC)CCN.Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1C(=O)O.Cc1[nH]c(C=O)c(C)c1C(=O)O |
| InChI | InChI=1S/C16H13FN2O3.C8H9NO3.C6H16N2/c1-7-13(18-8(2)14(7)16(21)22)6-11-10-5-9(17)3-4-12(10)19-15(11)20;1-4-6(3-10)9-5(2)7(4)8(11)12;1-3-8(4-2)6-5-7/h3-6,18H,1-2H3,(H,19,20)(H,21,22);3,9H,1-2H3,(H,11,12);3-7H2,1-2H3/b11-6-;; |
| InChIKey | VLPZYJVDONIIJA-LEOXJOGCSA-N |
| XLogP | 4.39 |
| TPSA | 181.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|