C27H36FN5O3 — CID 67985252
N-(butylcarbamoyl)-N-[2-(diethylamino)ethyl]-5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 67985252) has the molecular formula C27H36FN5O3 and a molecular weight of 497.62 g/mol. Its IUPAC name is N-(butylcarbamoyl)-N-[2-(diethylamino)ethyl]-5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-(butylcarbamoyl)-N-[2-(diethylamino)ethyl]-5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67985252 |
| Molecular Formula | C27H36FN5O3 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | N-(butylcarbamoyl)-N-[2-(diethylamino)ethyl]-5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | CCCCNC(=O)N(CCN(CC)CC)C(=O)c1c(C)[nH]c(C=C2C(=O)Nc3ccc(F)cc32)c1C |
| InChI | InChI=1S/C27H36FN5O3/c1-6-9-12-29-27(36)33(14-13-32(7-2)8-3)26(35)24-17(4)23(30-18(24)5)16-21-20-15-19(28)10-11-22(20)31-25(21)34/h10-11,15-16,30H,6-9,12-14H2,1-5H3,(H,29,36)(H,31,34) |
| InChIKey | COSCNONDKGFNBF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|