C29H40FN5O4 — CID 67985382
6-aminohexyl N-[2-(diethylamino)ethyl]-N-[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]carbamate (PubChem CID 67985382) has the molecular formula C29H40FN5O4 and a molecular weight of 541.67 g/mol. Its IUPAC name is 6-aminohexyl N-[2-(diethylamino)ethyl]-N-[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]carbamate.
| Compound Name | 6-aminohexyl N-[2-(diethylamino)ethyl]-N-[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 67985382 |
| Molecular Formula | C29H40FN5O4 |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | 6-aminohexyl N-[2-(diethylamino)ethyl]-N-[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]carbamate |
| SMILES | CCN(CC)CCN(C(=O)OCCCCCCN)C(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c1C |
| InChI | InChI=1S/C29H40FN5O4/c1-5-34(6-2)14-15-35(29(38)39-16-10-8-7-9-13-31)28(37)26-19(3)25(32-20(26)4)18-23-22-17-21(30)11-12-24(22)33-27(23)36/h11-12,17-18,32H,5-10,13-16,31H2,1-4H3,(H,33,36)/b23-18- |
| InChIKey | KUUQBZVUWWMUHR-NKFKGCMQSA-N |
| XLogP | 4.70 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|