C24H33FN4O4 — CID 143645303
5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde;5-(methylamino)pentan-1-ol;N-methylformamide (PubChem CID 143645303) has the molecular formula C24H33FN4O4 and a molecular weight of 460.55 g/mol. Its IUPAC name is 5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde;5-(methylamino)pentan-1-ol;N-methylformamide.
| Compound Name | 5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde;5-(methylamino)pentan-1-ol;N-methylformamide |
|---|---|
| PubChem CID | 143645303 |
| Molecular Formula | C24H33FN4O4 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbaldehyde;5-(methylamino)pentan-1-ol;N-methylformamide |
| SMILES | CNC=O.CNCCCCCO.Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1C=O |
| InChI | InChI=1S/C16H13FN2O2.C6H15NO.C2H5NO/c1-8-13(7-20)9(2)18-15(8)6-12-11-5-10(17)3-4-14(11)19-16(12)21;1-7-5-3-2-4-6-8;1-3-2-4/h3-7,18H,1-2H3,(H,19,21);7-8H,2-6H2,1H3;2H,1H3,(H,3,4)/b12-6-;; |
| InChIKey | QDAJESONWNTTBP-AXAVVADUSA-N |
| XLogP | 2.81 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|