C26H33FN4O4 — CID 24999521
[8-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methylamino]octanoylamino] acetate (PubChem CID 24999521) has the molecular formula C26H33FN4O4 and a molecular weight of 484.57 g/mol. Its IUPAC name is [8-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methylamino]octanoylamino] acetate.
| Compound Name | [8-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methylamino]octanoylamino] acetate |
|---|---|
| PubChem CID | 24999521 |
| Molecular Formula | C26H33FN4O4 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | [8-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methylamino]octanoylamino] acetate |
| SMILES | CC(=O)ONC(=O)CCCCCCCNCc1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c1C |
| InChI | InChI=1S/C26H33FN4O4/c1-16-22(15-28-12-8-6-4-5-7-9-25(33)31-35-18(3)32)17(2)29-24(16)14-21-20-13-19(27)10-11-23(20)30-26(21)34/h10-11,13-14,28-29H,4-9,12,15H2,1-3H3,(H,30,34)(H,31,33)/b21-14- |
| InChIKey | IAAKMJADTILXCO-STZFKDTASA-N |
| XLogP | 4.29 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|