C28H35FN4O5 — CID 173046404
[8-[[1-ethyl-5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethylpyrrole-3-carbonyl]amino]octanoylamino] acetate (PubChem CID 173046404) has the molecular formula C28H35FN4O5 and a molecular weight of 526.61 g/mol. Its IUPAC name is [8-[[1-ethyl-5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethylpyrrole-3-carbonyl]amino]octanoylamino] acetate.
| Compound Name | [8-[[1-ethyl-5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethylpyrrole-3-carbonyl]amino]octanoylamino] acetate |
|---|---|
| PubChem CID | 173046404 |
| Molecular Formula | C28H35FN4O5 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | [8-[[1-ethyl-5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethylpyrrole-3-carbonyl]amino]octanoylamino] acetate |
| SMILES | CCn1c(C)c(C(=O)NCCCCCCCC(=O)NOC(C)=O)c(C)c1C=C1C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C28H35FN4O5/c1-5-33-18(3)26(28(37)30-14-10-8-6-7-9-11-25(35)32-38-19(4)34)17(2)24(33)16-22-21-15-20(29)12-13-23(21)31-27(22)36/h12-13,15-16H,5-11,14H2,1-4H3,(H,30,37)(H,31,36)(H,32,35) |
| InChIKey | JSRQTJVDDOMJEO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|