C27H36FN5O5 — CID 123560891
2-(2-aminoethoxy)ethyl 4-[2-(diethylamino)ethylcarbamoyl]-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3,5-dimethylpyrrole-1-carboxylate (PubChem CID 123560891) has the molecular formula C27H36FN5O5 and a molecular weight of 529.61 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 4-[2-(diethylamino)ethylcarbamoyl]-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3,5-dimethylpyrrole-1-carboxylate.
| Compound Name | 2-(2-aminoethoxy)ethyl 4-[2-(diethylamino)ethylcarbamoyl]-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3,5-dimethylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 123560891 |
| Molecular Formula | C27H36FN5O5 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl 4-[2-(diethylamino)ethylcarbamoyl]-2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3,5-dimethylpyrrole-1-carboxylate |
| SMILES | CCN(CC)CCNC(=O)c1c(C)c(C=C2C(=O)Nc3ccc(F)cc32)n(C(=O)OCCOCCN)c1C |
| InChI | InChI=1S/C27H36FN5O5/c1-5-32(6-2)11-10-30-26(35)24-17(3)23(33(18(24)4)27(36)38-14-13-37-12-9-29)16-21-20-15-19(28)7-8-22(20)31-25(21)34/h7-8,15-16H,5-6,9-14,29H2,1-4H3,(H,30,35)(H,31,34) |
| InChIKey | SXVOXLHWEPSGPF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|