C20H22FN3O2S — CID 143829458
N-[2-(diethylamino)ethyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]thiophene-2-carboxamide (PubChem CID 143829458) has the molecular formula C20H22FN3O2S and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143829458 |
| Molecular Formula | C20H22FN3O2S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]thiophene-2-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(/C=C2\C(=O)Nc3ccc(F)cc32)s1 |
| InChI | InChI=1S/C20H22FN3O2S/c1-3-24(4-2)10-9-22-20(26)18-8-6-14(27-18)12-16-15-11-13(21)5-7-17(15)23-19(16)25/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,22,26)(H,23,25)/b16-12- |
| InChIKey | LHBJYYHWTLTDEZ-VBKFSLOCSA-N |
| XLogP | 3.45 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|