C15H12FN3O3 — CID 25058967
(3Z)-3-[(3,5-dimethyl-4-nitro-1H-pyrrol-2-yl)methylidene]-5-fluoro-1H-indol-2-one (PubChem CID 25058967) has the molecular formula C15H12FN3O3 and a molecular weight of 301.28 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethyl-4-nitro-1H-pyrrol-2-yl)methylidene]-5-fluoro-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3,5-dimethyl-4-nitro-1H-pyrrol-2-yl)methylidene]-5-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 25058967 |
| Molecular Formula | C15H12FN3O3 |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (3Z)-3-[(3,5-dimethyl-4-nitro-1H-pyrrol-2-yl)methylidene]-5-fluoro-1H-indol-2-one |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12FN3O3/c1-7-13(17-8(2)14(7)19(21)22)6-11-10-5-9(16)3-4-12(10)18-15(11)20/h3-6,17H,1-2H3,(H,18,20)/b11-6- |
| InChIKey | NOSDZRIXDGVQLC-WDZFZDKYSA-N |
| XLogP | 3.17 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|