C26H26N4O4 — CID 168832236
(3Z)-3-[(3,5-dimethyl-4-nitro-1H-pyrrol-2-yl)methylidene]-N-[(1R)-2-methyl-1-phenylpropyl]-2-oxo-1H-indole-5-carboxamide (PubChem CID 168832236) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethyl-4-nitro-1H-pyrrol-2-yl)methylidene]-N-[(1R)-2-methyl-1-phenylpropyl]-2-oxo-1H-indole-5-carboxamide.
| Compound Name | (3Z)-3-[(3,5-dimethyl-4-nitro-1H-pyrrol-2-yl)methylidene]-N-[(1R)-2-methyl-1-phenylpropyl]-2-oxo-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 168832236 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (3Z)-3-[(3,5-dimethyl-4-nitro-1H-pyrrol-2-yl)methylidene]-N-[(1R)-2-methyl-1-phenylpropyl]-2-oxo-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(C(=O)N[C@@H](c4ccccc4)C(C)C)cc32)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H26N4O4/c1-14(2)23(17-8-6-5-7-9-17)29-25(31)18-10-11-21-19(12-18)20(26(32)28-21)13-22-15(3)24(30(33)34)16(4)27-22/h5-14,23,27H,1-4H3,(H,28,32)(H,29,31)/b20-13-/t23-/m1/s1 |
| InChIKey | SMPWJQUOCAIOQE-JPFXZVHCSA-N |
| XLogP | 5.16 |
| TPSA | 117.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|