C17H18N2O4S — CID 91308431
tert-butyl 4-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-5-oxo-6H-thieno[2,3-b]pyrrole-2-carboxylate (PubChem CID 91308431) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is tert-butyl 4-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-5-oxo-6H-thieno[2,3-b]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 4-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-5-oxo-6H-thieno[2,3-b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 91308431 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | tert-butyl 4-[(3-methoxy-1H-pyrrol-2-yl)methylidene]-5-oxo-6H-thieno[2,3-b]pyrrole-2-carboxylate |
| SMILES | COc1cc[nH]c1C=C1C(=O)Nc2sc(C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C17H18N2O4S/c1-17(2,3)23-16(21)13-8-10-9(14(20)19-15(10)24-13)7-11-12(22-4)5-6-18-11/h5-8,18H,1-4H3,(H,19,20) |
| InChIKey | VZGNSDJLWXXTCT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|