C13H10N2O3S — CID 91334341
methyl 5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxylate (PubChem CID 91334341) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is methyl 5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxylate.
| Compound Name | methyl 5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 91334341 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | methyl 5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)NC(=O)C2=Cc1ccc[nH]1 |
| InChI | InChI=1S/C13H10N2O3S/c1-18-13(17)10-6-9-8(5-7-3-2-4-14-7)11(16)15-12(9)19-10/h2-6,14H,1H3,(H,15,16) |
| InChIKey | VSNAJLXNIXNZSD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|