C22H18N4O2S — CID 70004445
N-[2-(1H-indol-3-yl)ethyl]-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxamide (PubChem CID 70004445) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 70004445 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxamide |
| SMILES | O=C1Nc2sc(C(=O)NCCc3c[nH]c4ccccc34)cc2C1=Cc1ccc[nH]1 |
| InChI | InChI=1S/C22H18N4O2S/c27-20-16(10-14-4-3-8-23-14)17-11-19(29-22(17)26-20)21(28)24-9-7-13-12-25-18-6-2-1-5-15(13)18/h1-6,8,10-12,23,25H,7,9H2,(H,24,28)(H,26,27) |
| InChIKey | BHCAACXYBYDFIC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|