C17H16N2O3 — CID 56932526
[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-5-yl] butanoate (PubChem CID 56932526) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is [(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-5-yl] butanoate.
| Compound Name | [(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-5-yl] butanoate |
|---|---|
| PubChem CID | 56932526 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-5-yl] butanoate |
| SMILES | CCCC(=O)Oc1ccc2c(c1)/C(=C/c1ccc[nH]1)C(=O)N2 |
| InChI | InChI=1S/C17H16N2O3/c1-2-4-16(20)22-12-6-7-15-13(10-12)14(17(21)19-15)9-11-5-3-8-18-11/h3,5-10,18H,2,4H2,1H3,(H,19,21)/b14-9- |
| InChIKey | BKCBXWHREYQMAE-ZROIWOOFSA-N |
| XLogP | 3.21 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|