C18H14N2O2S — CID 177494788
(3E)-5-[hydroxy(thiophen-2-yl)methyl]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one (PubChem CID 177494788) has the molecular formula C18H14N2O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is (3E)-5-[hydroxy(thiophen-2-yl)methyl]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one.
| Compound Name | (3E)-5-[hydroxy(thiophen-2-yl)methyl]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 177494788 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (3E)-5-[hydroxy(thiophen-2-yl)methyl]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(C(O)c3cccs3)cc2/C1=C\c1ccc[nH]1 |
| InChI | InChI=1S/C18H14N2O2S/c21-17(16-4-2-8-23-16)11-5-6-15-13(9-11)14(18(22)20-15)10-12-3-1-7-19-12/h1-10,17,19,21H,(H,20,22)/b14-10+ |
| InChIKey | DFKYHHCMFRBWRU-GXDHUFHOSA-N |
| XLogP | 3.65 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|