C20H16FN3O — CID 175592071
5-[(4-fluorophenyl)methylamino]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one (PubChem CID 175592071) has the molecular formula C20H16FN3O and a molecular weight of 333.37 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methylamino]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one.
| Compound Name | 5-[(4-fluorophenyl)methylamino]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 175592071 |
| Molecular Formula | C20H16FN3O |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 5-[(4-fluorophenyl)methylamino]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(NCc3ccc(F)cc3)cc2C1=Cc1ccc[nH]1 |
| InChI | InChI=1S/C20H16FN3O/c21-14-5-3-13(4-6-14)12-23-16-7-8-19-17(10-16)18(20(25)24-19)11-15-2-1-9-22-15/h1-11,22-23H,12H2,(H,24,25) |
| InChIKey | MKZYONWSQJFPIG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|