C19H16FN5O2 — CID 175592086
5-[(5-fluoro-2-methoxy-3-pyridinyl)methylamino]-3-(1H-imidazol-5-ylmethylidene)-1H-indol-2-one (PubChem CID 175592086) has the molecular formula C19H16FN5O2 and a molecular weight of 365.37 g/mol. Its IUPAC name is 5-[(5-fluoro-2-methoxy-3-pyridinyl)methylamino]-3-(1H-imidazol-5-ylmethylidene)-1H-indol-2-one.
| Compound Name | 5-[(5-fluoro-2-methoxy-3-pyridinyl)methylamino]-3-(1H-imidazol-5-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 175592086 |
| Molecular Formula | C19H16FN5O2 |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 5-[(5-fluoro-2-methoxy-3-pyridinyl)methylamino]-3-(1H-imidazol-5-ylmethylidene)-1H-indol-2-one |
| SMILES | COc1ncc(F)cc1CNc1ccc2c(c1)C(=Cc1cnc[nH]1)C(=O)N2 |
| InChI | InChI=1S/C19H16FN5O2/c1-27-19-11(4-12(20)8-23-19)7-22-13-2-3-17-15(5-13)16(18(26)25-17)6-14-9-21-10-24-14/h2-6,8-10,22H,7H2,1H3,(H,21,24)(H,25,26) |
| InChIKey | PNLJYTCFDTVENK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|