C14H14N4O3S — CID 177373730
(3Z)-3-(1H-imidazol-5-ylmethylidene)-N,N-dimethyl-2-oxo-1H-indole-5-sulfonamide (PubChem CID 177373730) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is (3Z)-3-(1H-imidazol-5-ylmethylidene)-N,N-dimethyl-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | (3Z)-3-(1H-imidazol-5-ylmethylidene)-N,N-dimethyl-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 177373730 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (3Z)-3-(1H-imidazol-5-ylmethylidene)-N,N-dimethyl-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)/C(=C/c1cnc[nH]1)C(=O)N2 |
| InChI | InChI=1S/C14H14N4O3S/c1-18(2)22(20,21)10-3-4-13-11(6-10)12(14(19)17-13)5-9-7-15-8-16-9/h3-8H,1-2H3,(H,15,16)(H,17,19)/b12-5- |
| InChIKey | ZFBKQDPIMPQLLI-XGICHPGQSA-N |
| XLogP | 1.15 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|