C20H19N3O3S — CID 69345180
N,N-dimethyl-3-[(2-methyl-1H-indol-3-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide (PubChem CID 69345180) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is N,N-dimethyl-3-[(2-methyl-1H-indol-3-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | N,N-dimethyl-3-[(2-methyl-1H-indol-3-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 69345180 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N,N-dimethyl-3-[(2-methyl-1H-indol-3-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
| SMILES | Cc1[nH]c2ccccc2c1C=C1C(=O)Nc2ccc(S(=O)(=O)N(C)C)cc21 |
| InChI | InChI=1S/C20H19N3O3S/c1-12-15(14-6-4-5-7-18(14)21-12)11-17-16-10-13(27(25,26)23(2)3)8-9-19(16)22-20(17)24/h4-11,21H,1-3H3,(H,22,24) |
| InChIKey | QWOHQPWRFZHHKV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|