C18H18N2O3S — CID 3428131
3-formyl-N,N-dimethyl-2-(2-methylphenyl)-1H-indole-5-sulfonamide (PubChem CID 3428131) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-formyl-N,N-dimethyl-2-(2-methylphenyl)-1H-indole-5-sulfonamide.
| Compound Name | 3-formyl-N,N-dimethyl-2-(2-methylphenyl)-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 3428131 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-formyl-N,N-dimethyl-2-(2-methylphenyl)-1H-indole-5-sulfonamide |
| SMILES | Cc1ccccc1-c1[nH]c2ccc(S(=O)(=O)N(C)C)cc2c1C=O |
| InChI | InChI=1S/C18H18N2O3S/c1-12-6-4-5-7-14(12)18-16(11-21)15-10-13(8-9-17(15)19-18)24(22,23)20(2)3/h4-11,19H,1-3H3 |
| InChIKey | FWWZFCONVXHYMU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|