C18H15F3N2O3S — CID 3710473
3-formyl-N,N-dimethyl-2-[3-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 3710473) has the molecular formula C18H15F3N2O3S and a molecular weight of 396.39 g/mol. Its IUPAC name is 3-formyl-N,N-dimethyl-2-[3-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 3-formyl-N,N-dimethyl-2-[3-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 3710473 |
| Molecular Formula | C18H15F3N2O3S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-formyl-N,N-dimethyl-2-[3-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2[nH]c(-c3cccc(C(F)(F)F)c3)c(C=O)c2c1 |
| InChI | InChI=1S/C18H15F3N2O3S/c1-23(2)27(25,26)13-6-7-16-14(9-13)15(10-24)17(22-16)11-4-3-5-12(8-11)18(19,20)21/h3-10,22H,1-2H3 |
| InChIKey | DZSREVCBFFHRCB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|