C15H20N2O3S — CID 3802955
2-tert-butyl-3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide (PubChem CID 3802955) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-tert-butyl-3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide.
| Compound Name | 2-tert-butyl-3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 3802955 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-tert-butyl-3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2[nH]c(C(C)(C)C)c(C=O)c2c1 |
| InChI | InChI=1S/C15H20N2O3S/c1-15(2,3)14-12(9-18)11-8-10(6-7-13(11)16-14)21(19,20)17(4)5/h6-9,16H,1-5H3 |
| InChIKey | GNZRABHTGWGYTF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|