C10H13N3O2S — CID 90823817
2-amino-N,N-dimethyl-1H-indole-6-sulfonamide (PubChem CID 90823817) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-1H-indole-6-sulfonamide.
| Compound Name | 2-amino-N,N-dimethyl-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 90823817 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-amino-N,N-dimethyl-1H-indole-6-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2cc(N)[nH]c2c1 |
| InChI | InChI=1S/C10H13N3O2S/c1-13(2)16(14,15)8-4-3-7-5-10(11)12-9(7)6-8/h3-6,12H,11H2,1-2H3 |
| InChIKey | FCLHZTGFFDZANC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |