C19H20N4O4S — CID 55560204
N,N-dimethyl-3-[[(6-methyl-1H-indole-2-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 55560204) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is N,N-dimethyl-3-[[(6-methyl-1H-indole-2-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[[(6-methyl-1H-indole-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55560204 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N,N-dimethyl-3-[[(6-methyl-1H-indole-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1ccc2cc(C(=O)NNC(=O)c3cccc(S(=O)(=O)N(C)C)c3)[nH]c2c1 |
| InChI | InChI=1S/C19H20N4O4S/c1-12-7-8-13-11-17(20-16(13)9-12)19(25)22-21-18(24)14-5-4-6-15(10-14)28(26,27)23(2)3/h4-11,20H,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | GFVAYMUBGVBRBC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|