C19H23N3O3S — CID 9359863
N-[(Z)-1-(2,5-dimethylphenyl)ethylideneamino]-3-(dimethylsulfamoyl)benzamide (PubChem CID 9359863) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dimethylphenyl)ethylideneamino]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[(Z)-1-(2,5-dimethylphenyl)ethylideneamino]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9359863 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[(Z)-1-(2,5-dimethylphenyl)ethylideneamino]-3-(dimethylsulfamoyl)benzamide |
| SMILES | C/C(=N/NC(=O)c1cccc(S(=O)(=O)N(C)C)c1)c1cc(C)ccc1C |
| InChI | InChI=1S/C19H23N3O3S/c1-13-9-10-14(2)18(11-13)15(3)20-21-19(23)16-7-6-8-17(12-16)26(24,25)22(4)5/h6-12H,1-5H3,(H,21,23)/b20-15- |
| InChIKey | SGHFDKCRFDYSFL-HKWRFOASSA-N |
| XLogP | 2.71 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|