C21H28N4O6S2 — CID 24536143
N,N-dimethyl-3-[[[(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 24536143) has the molecular formula C21H28N4O6S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is N,N-dimethyl-3-[[[(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[[[(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24536143 |
| Molecular Formula | C21H28N4O6S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N,N-dimethyl-3-[[[(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C(=O)NNC(=O)c2cccc(S(=O)(=O)N(C)C)c2)C(C)C)cc1 |
| InChI | InChI=1S/C21H28N4O6S2/c1-14(2)19(24-32(28,29)17-11-9-15(3)10-12-17)21(27)23-22-20(26)16-7-6-8-18(13-16)33(30,31)25(4)5/h6-14,19,24H,1-5H3,(H,22,26)(H,23,27)/t19-/m0/s1 |
| InChIKey | SPSPWCUXMOYLLD-IBGZPJMESA-N |
| XLogP | 1.01 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|