C14H22N4O3S2 — CID 9425452
1-tert-butyl-3-[[3-(dimethylsulfamoyl)benzoyl]amino]thiourea (PubChem CID 9425452) has the molecular formula C14H22N4O3S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-tert-butyl-3-[[3-(dimethylsulfamoyl)benzoyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[3-(dimethylsulfamoyl)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 9425452 |
| Molecular Formula | C14H22N4O3S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-tert-butyl-3-[[3-(dimethylsulfamoyl)benzoyl]amino]thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NNC(=S)NC(C)(C)C)c1 |
| InChI | InChI=1S/C14H22N4O3S2/c1-14(2,3)15-13(22)17-16-12(19)10-7-6-8-11(9-10)23(20,21)18(4)5/h6-9H,1-5H3,(H,16,19)(H2,15,17,22) |
| InChIKey | LQWDTPZHAOUEGU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|