C19H18F2N2O3S — CID 3827821
2-(3,4-difluorophenyl)-N,N-diethyl-3-formyl-1H-indole-5-sulfonamide (PubChem CID 3827821) has the molecular formula C19H18F2N2O3S and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N,N-diethyl-3-formyl-1H-indole-5-sulfonamide.
| Compound Name | 2-(3,4-difluorophenyl)-N,N-diethyl-3-formyl-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 3827821 |
| Molecular Formula | C19H18F2N2O3S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N,N-diethyl-3-formyl-1H-indole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2[nH]c(-c3ccc(F)c(F)c3)c(C=O)c2c1 |
| InChI | InChI=1S/C19H18F2N2O3S/c1-3-23(4-2)27(25,26)13-6-8-18-14(10-13)15(11-24)19(22-18)12-5-7-16(20)17(21)9-12/h5-11,22H,3-4H2,1-2H3 |
| InChIKey | GNYFKZXOQPJCSM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|