C17H24N2O3S — CID 4258004
2-tert-butyl-N,N-diethyl-3-formyl-1H-indole-5-sulfonamide (PubChem CID 4258004) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-tert-butyl-N,N-diethyl-3-formyl-1H-indole-5-sulfonamide.
| Compound Name | 2-tert-butyl-N,N-diethyl-3-formyl-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 4258004 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-tert-butyl-N,N-diethyl-3-formyl-1H-indole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2[nH]c(C(C)(C)C)c(C=O)c2c1 |
| InChI | InChI=1S/C17H24N2O3S/c1-6-19(7-2)23(21,22)12-8-9-15-13(10-12)14(11-20)16(18-15)17(3,4)5/h8-11,18H,6-7H2,1-5H3 |
| InChIKey | WULMSRIKMHTNPQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|