C16H23ClN4O4S — CID 119384301
N-(2-aminoethyl)-6-(diethylsulfamoyl)-2-oxo-1H-quinoline-4-carboxamide;hydrochloride (PubChem CID 119384301) has the molecular formula C16H23ClN4O4S and a molecular weight of 402.90 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-(diethylsulfamoyl)-2-oxo-1H-quinoline-4-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-6-(diethylsulfamoyl)-2-oxo-1H-quinoline-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119384301 |
| Molecular Formula | C16H23ClN4O4S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-(2-aminoethyl)-6-(diethylsulfamoyl)-2-oxo-1H-quinoline-4-carboxamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2[nH]c(=O)cc(C(=O)NCCN)c2c1.Cl |
| InChI | InChI=1S/C16H22N4O4S.ClH/c1-3-20(4-2)25(23,24)11-5-6-14-12(9-11)13(10-15(21)19-14)16(22)18-8-7-17;/h5-6,9-10H,3-4,7-8,17H2,1-2H3,(H,18,22)(H,19,21);1H |
| InChIKey | IOTTUVYJZUJCCQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |