C18H26N4O4S — CID 120829777
6-(diethylsulfamoyl)-N-[2-(methylamino)propyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 120829777) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is 6-(diethylsulfamoyl)-N-[2-(methylamino)propyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | 6-(diethylsulfamoyl)-N-[2-(methylamino)propyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 120829777 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 6-(diethylsulfamoyl)-N-[2-(methylamino)propyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2[nH]c(=O)cc(C(=O)NCC(C)NC)c2c1 |
| InChI | InChI=1S/C18H26N4O4S/c1-5-22(6-2)27(25,26)13-7-8-16-14(9-13)15(10-17(23)21-16)18(24)20-11-12(3)19-4/h7-10,12,19H,5-6,11H2,1-4H3,(H,20,24)(H,21,23) |
| InChIKey | WEYBRWQEEMWPRZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |