C22H24FN3O4S — CID 41365118
6-(diethylsulfamoyl)-N-[2-(3-fluorophenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 41365118) has the molecular formula C22H24FN3O4S and a molecular weight of 445.52 g/mol. Its IUPAC name is 6-(diethylsulfamoyl)-N-[2-(3-fluorophenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | 6-(diethylsulfamoyl)-N-[2-(3-fluorophenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 41365118 |
| Molecular Formula | C22H24FN3O4S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 6-(diethylsulfamoyl)-N-[2-(3-fluorophenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2[nH]c(=O)cc(C(=O)NCCc3cccc(F)c3)c2c1 |
| InChI | InChI=1S/C22H24FN3O4S/c1-3-26(4-2)31(29,30)17-8-9-20-18(13-17)19(14-21(27)25-20)22(28)24-11-10-15-6-5-7-16(23)12-15/h5-9,12-14H,3-4,10-11H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | QONHPBHRMPRLQZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |