C22H25N5O6S — CID 41275498
6-(diethylsulfamoyl)-N-[2-(2-nitroanilino)ethyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 41275498) has the molecular formula C22H25N5O6S and a molecular weight of 487.54 g/mol. Its IUPAC name is 6-(diethylsulfamoyl)-N-[2-(2-nitroanilino)ethyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | 6-(diethylsulfamoyl)-N-[2-(2-nitroanilino)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 41275498 |
| Molecular Formula | C22H25N5O6S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 6-(diethylsulfamoyl)-N-[2-(2-nitroanilino)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2[nH]c(=O)cc(C(=O)NCCNc3ccccc3[N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C22H25N5O6S/c1-3-26(4-2)34(32,33)15-9-10-18-16(13-15)17(14-21(28)25-18)22(29)24-12-11-23-19-7-5-6-8-20(19)27(30)31/h5-10,13-14,23H,3-4,11-12H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | QJSXLTKEJILHOG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|