C20H22N2O3S — CID 3830629
3-formyl-N,N-dimethyl-2-(4-propan-2-ylphenyl)-1H-indole-5-sulfonamide (PubChem CID 3830629) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-formyl-N,N-dimethyl-2-(4-propan-2-ylphenyl)-1H-indole-5-sulfonamide.
| Compound Name | 3-formyl-N,N-dimethyl-2-(4-propan-2-ylphenyl)-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 3830629 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-formyl-N,N-dimethyl-2-(4-propan-2-ylphenyl)-1H-indole-5-sulfonamide |
| SMILES | CC(C)c1ccc(-c2[nH]c3ccc(S(=O)(=O)N(C)C)cc3c2C=O)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-13(2)14-5-7-15(8-6-14)20-18(12-23)17-11-16(9-10-19(17)21-20)26(24,25)22(3)4/h5-13,21H,1-4H3 |
| InChIKey | CRPZTANCIYKKBM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|