C15H12Cl2N2O3S2 — CID 3489587
2-(2,5-dichlorothiophen-3-yl)-3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide (PubChem CID 3489587) has the molecular formula C15H12Cl2N2O3S2 and a molecular weight of 403.31 g/mol. Its IUPAC name is 2-(2,5-dichlorothiophen-3-yl)-3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide.
| Compound Name | 2-(2,5-dichlorothiophen-3-yl)-3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 3489587 |
| Molecular Formula | C15H12Cl2N2O3S2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 2-(2,5-dichlorothiophen-3-yl)-3-formyl-N,N-dimethyl-1H-indole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2[nH]c(-c3cc(Cl)sc3Cl)c(C=O)c2c1 |
| InChI | InChI=1S/C15H12Cl2N2O3S2/c1-19(2)24(21,22)8-3-4-12-9(5-8)11(7-20)14(18-12)10-6-13(16)23-15(10)17/h3-7,18H,1-2H3 |
| InChIKey | ONFSDVMLUZJSKD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|