C21H20F2N2O3S — CID 3765830
5-(azepan-1-ylsulfonyl)-2-(3,4-difluorophenyl)-1H-indole-3-carbaldehyde (PubChem CID 3765830) has the molecular formula C21H20F2N2O3S and a molecular weight of 418.47 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-(3,4-difluorophenyl)-1H-indole-3-carbaldehyde.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-(3,4-difluorophenyl)-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 3765830 |
| Molecular Formula | C21H20F2N2O3S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-(3,4-difluorophenyl)-1H-indole-3-carbaldehyde |
| SMILES | O=Cc1c(-c2ccc(F)c(F)c2)[nH]c2ccc(S(=O)(=O)N3CCCCCC3)cc12 |
| InChI | InChI=1S/C21H20F2N2O3S/c22-18-7-5-14(11-19(18)23)21-17(13-26)16-12-15(6-8-20(16)24-21)29(27,28)25-9-3-1-2-4-10-25/h5-8,11-13,24H,1-4,9-10H2 |
| InChIKey | SKLQKTOZSJSVIU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|