C20H18F2N2O3S — CID 3807724
2-(2,4-difluorophenyl)-5-piperidin-1-ylsulfonyl-1H-indole-3-carbaldehyde (PubChem CID 3807724) has the molecular formula C20H18F2N2O3S and a molecular weight of 404.44 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-5-piperidin-1-ylsulfonyl-1H-indole-3-carbaldehyde.
| Compound Name | 2-(2,4-difluorophenyl)-5-piperidin-1-ylsulfonyl-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 3807724 |
| Molecular Formula | C20H18F2N2O3S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-(2,4-difluorophenyl)-5-piperidin-1-ylsulfonyl-1H-indole-3-carbaldehyde |
| SMILES | O=Cc1c(-c2ccc(F)cc2F)[nH]c2ccc(S(=O)(=O)N3CCCCC3)cc12 |
| InChI | InChI=1S/C20H18F2N2O3S/c21-13-4-6-15(18(22)10-13)20-17(12-25)16-11-14(5-7-19(16)23-20)28(26,27)24-8-2-1-3-9-24/h4-7,10-12,23H,1-3,8-9H2 |
| InChIKey | NEBKQWTWEFYPGX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|