C17H16F2N2O5S — CID 39743079
1-[4-(2,4-difluorophenoxy)-3-nitrophenyl]sulfonylpiperidine (PubChem CID 39743079) has the molecular formula C17H16F2N2O5S and a molecular weight of 398.39 g/mol. Its IUPAC name is 1-[4-(2,4-difluorophenoxy)-3-nitrophenyl]sulfonylpiperidine.
| Compound Name | 1-[4-(2,4-difluorophenoxy)-3-nitrophenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 39743079 |
| Molecular Formula | C17H16F2N2O5S |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 1-[4-(2,4-difluorophenoxy)-3-nitrophenyl]sulfonylpiperidine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C17H16F2N2O5S/c18-12-4-6-16(14(19)10-12)26-17-7-5-13(11-15(17)21(22)23)27(24,25)20-8-2-1-3-9-20/h4-7,10-11H,1-3,8-9H2 |
| InChIKey | GWUQLKCFWJPSBZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|