C20H19ClN2O5S — CID 3803877
2-(5-chloro-2-methoxyphenyl)-5-morpholin-4-ylsulfonyl-1H-indole-3-carbaldehyde (PubChem CID 3803877) has the molecular formula C20H19ClN2O5S and a molecular weight of 434.90 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-5-morpholin-4-ylsulfonyl-1H-indole-3-carbaldehyde.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-5-morpholin-4-ylsulfonyl-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 3803877 |
| Molecular Formula | C20H19ClN2O5S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-5-morpholin-4-ylsulfonyl-1H-indole-3-carbaldehyde |
| SMILES | COc1ccc(Cl)cc1-c1[nH]c2ccc(S(=O)(=O)N3CCOCC3)cc2c1C=O |
| InChI | InChI=1S/C20H19ClN2O5S/c1-27-19-5-2-13(21)10-16(19)20-17(12-24)15-11-14(3-4-18(15)22-20)29(25,26)23-6-8-28-9-7-23/h2-5,10-12,22H,6-9H2,1H3 |
| InChIKey | PACJXHNHHULKJO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|