C16H23N3O2S — CID 4260015
2-(2-methyl-5-piperidin-1-ylsulfonyl-1H-indol-3-yl)ethanamine (PubChem CID 4260015) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 2-(2-methyl-5-piperidin-1-ylsulfonyl-1H-indol-3-yl)ethanamine.
| Compound Name | 2-(2-methyl-5-piperidin-1-ylsulfonyl-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 4260015 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-(2-methyl-5-piperidin-1-ylsulfonyl-1H-indol-3-yl)ethanamine |
| SMILES | Cc1[nH]c2ccc(S(=O)(=O)N3CCCCC3)cc2c1CCN |
| InChI | InChI=1S/C16H23N3O2S/c1-12-14(7-8-17)15-11-13(5-6-16(15)18-12)22(20,21)19-9-3-2-4-10-19/h5-6,11,18H,2-4,7-10,17H2,1H3 |
| InChIKey | OMNPFGRZUADPDA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|