C13H17N3O2S — CID 177233056
3-methyl-6-piperidin-1-ylsulfonyl-2H-indazole (PubChem CID 177233056) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 3-methyl-6-piperidin-1-ylsulfonyl-2H-indazole.
| Compound Name | 3-methyl-6-piperidin-1-ylsulfonyl-2H-indazole |
|---|---|
| PubChem CID | 177233056 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-methyl-6-piperidin-1-ylsulfonyl-2H-indazole |
| SMILES | Cc1[nH]nc2cc(S(=O)(=O)N3CCCCC3)ccc12 |
| InChI | InChI=1S/C13H17N3O2S/c1-10-12-6-5-11(9-13(12)15-14-10)19(17,18)16-7-3-2-4-8-16/h5-6,9H,2-4,7-8H2,1H3,(H,14,15) |
| InChIKey | VEGQHZMGXFFGSD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |